C52H36N4S — CID 139964399
N-[4-[2-[4-(9H-carbazol-1-ylamino)phenyl]-4,5-diphenylthiophen-3-yl]phenyl]-9H-carbazol-1-amine (PubChem CID 139964399) has the molecular formula C52H36N4S and a molecular weight of 748.96 g/mol. Its IUPAC name is N-[4-[2-[4-(9H-carbazol-1-ylamino)phenyl]-4,5-diphenylthiophen-3-yl]phenyl]-9H-carbazol-1-amine.
| Compound Name | N-[4-[2-[4-(9H-carbazol-1-ylamino)phenyl]-4,5-diphenylthiophen-3-yl]phenyl]-9H-carbazol-1-amine |
|---|---|
| PubChem CID | 139964399 |
| Molecular Formula | C52H36N4S |
| Molecular Weight | 748.96 g/mol |
| Exact Mass | 748.27 |
| IUPAC Name | N-[4-[2-[4-(9H-carbazol-1-ylamino)phenyl]-4,5-diphenylthiophen-3-yl]phenyl]-9H-carbazol-1-amine |
| SMILES | c1ccc(-c2sc(-c3ccc(Nc4cccc5c4[nH]c4ccccc45)cc3)c(-c3ccc(Nc4cccc5c4[nH]c4ccccc45)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C52H36N4S/c1-3-13-33(14-4-1)47-48(34-25-29-37(30-26-34)53-45-23-11-19-41-39-17-7-9-21-43(39)55-49(41)45)52(57-51(47)35-15-5-2-6-16-35)36-27-31-38(32-28-36)54-46-24-12-20-42-40-18-8-10-22-44(40)56-50(42)46/h1-32,53-56H |
| InChIKey | QOJIZLWFKBZXJX-UHFFFAOYSA-N |
| XLogP | 15.17 |
| TPSA | 55.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.96 |
| LogP ≤ 5 | 15.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |