C42H34N6 — CID 175505714
4-N-[4-[N-[4-(4-aminoanilino)phenyl]-4-(9H-carbazol-1-yl)anilino]phenyl]benzene-1,4-diamine (PubChem CID 175505714) has the molecular formula C42H34N6 and a molecular weight of 622.78 g/mol. Its IUPAC name is 4-N-[4-[N-[4-(4-aminoanilino)phenyl]-4-(9H-carbazol-1-yl)anilino]phenyl]benzene-1,4-diamine.
| Compound Name | 4-N-[4-[N-[4-(4-aminoanilino)phenyl]-4-(9H-carbazol-1-yl)anilino]phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 175505714 |
| Molecular Formula | C42H34N6 |
| Molecular Weight | 622.78 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | 4-N-[4-[N-[4-(4-aminoanilino)phenyl]-4-(9H-carbazol-1-yl)anilino]phenyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ccc(N(c3ccc(Nc4ccc(N)cc4)cc3)c3ccc(-c4cccc5c4[nH]c4ccccc45)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H34N6/c43-29-10-14-31(15-11-29)45-33-18-24-36(25-19-33)48(37-26-20-34(21-27-37)46-32-16-12-30(44)13-17-32)35-22-8-28(9-23-35)38-5-3-6-40-39-4-1-2-7-41(39)47-42(38)40/h1-27,45-47H,43-44H2 |
| InChIKey | DIEKJSWWCRVCGT-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.78 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|