C26H23BF10NO4+ — CID 139966348
1-[2-bis(2,3,4,5,6-pentafluorophenoxy)boranyloxy-5-hydroxyphenyl]ethyl-triethylazanium (PubChem CID 139966348) has the molecular formula C26H23BF10NO4+ and a molecular weight of 614.27 g/mol. Its IUPAC name is 1-[2-bis(2,3,4,5,6-pentafluorophenoxy)boranyloxy-5-hydroxyphenyl]ethyl-triethylazanium.
| Compound Name | 1-[2-bis(2,3,4,5,6-pentafluorophenoxy)boranyloxy-5-hydroxyphenyl]ethyl-triethylazanium |
|---|---|
| PubChem CID | 139966348 |
| Molecular Formula | C26H23BF10NO4+ |
| Molecular Weight | 614.27 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | 1-[2-bis(2,3,4,5,6-pentafluorophenoxy)boranyloxy-5-hydroxyphenyl]ethyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)C(C)c1cc(O)ccc1OB(Oc1c(F)c(F)c(F)c(F)c1F)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H22BF10NO4/c1-5-38(6-2,7-3)11(4)13-10-12(39)8-9-14(13)40-27(41-25-21(34)17(30)15(28)18(31)22(25)35)42-26-23(36)19(32)16(29)20(33)24(26)37/h8-11H,5-7H2,1-4H3/p+1 |
| InChIKey | ATCULQNRAHADLB-UHFFFAOYSA-O |
| XLogP | 7.24 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.27 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|