C30H35N5O6 — CID 139969103
N-[(3S,4S)-4-[2-(hydroxyamino)-2-oxoethyl]-1-(morpholine-4-carbonyl)piperidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 139969103) has the molecular formula C30H35N5O6 and a molecular weight of 561.64 g/mol. Its IUPAC name is N-[(3S,4S)-4-[2-(hydroxyamino)-2-oxoethyl]-1-(morpholine-4-carbonyl)piperidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | N-[(3S,4S)-4-[2-(hydroxyamino)-2-oxoethyl]-1-(morpholine-4-carbonyl)piperidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 139969103 |
| Molecular Formula | C30H35N5O6 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | N-[(3S,4S)-4-[2-(hydroxyamino)-2-oxoethyl]-1-(morpholine-4-carbonyl)piperidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | Cc1cc(COc2ccc(C(=O)N[C@@H]3CN(C(=O)N4CCOCC4)CC[C@H]3CC(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C30H35N5O6/c1-20-16-23(25-4-2-3-5-26(25)31-20)19-41-24-8-6-21(7-9-24)29(37)32-27-18-35(11-10-22(27)17-28(36)33-39)30(38)34-12-14-40-15-13-34/h2-9,16,22,27,39H,10-15,17-19H2,1H3,(H,32,37)(H,33,36)/t22-,27+/m0/s1 |
| InChIKey | DVYVXTLOFQRVDT-WXVAWEFUSA-N |
| XLogP | 2.89 |
| TPSA | 133.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|