C14H17NO12S2 — CID 139970191
3-[3-nitro-5-(3-sulfopropoxycarbonyl)benzoyl]oxypropane-1-sulfonic acid (PubChem CID 139970191) has the molecular formula C14H17NO12S2 and a molecular weight of 455.42 g/mol. Its IUPAC name is 3-[3-nitro-5-(3-sulfopropoxycarbonyl)benzoyl]oxypropane-1-sulfonic acid.
| Compound Name | 3-[3-nitro-5-(3-sulfopropoxycarbonyl)benzoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 139970191 |
| Molecular Formula | C14H17NO12S2 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 3-[3-nitro-5-(3-sulfopropoxycarbonyl)benzoyl]oxypropane-1-sulfonic acid |
| SMILES | O=C(OCCCS(=O)(=O)O)c1cc(C(=O)OCCCS(=O)(=O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H17NO12S2/c16-13(26-3-1-5-28(20,21)22)10-7-11(9-12(8-10)15(18)19)14(17)27-4-2-6-29(23,24)25/h7-9H,1-6H2,(H,20,21,22)(H,23,24,25) |
| InChIKey | IMFSJONTCJWOKI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 204.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|