C14H17N3O3 — CID 139970374
2-[2-(hydroxymethyl)imidazol-1-yl]ethyl N-benzylcarbamate (PubChem CID 139970374) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)imidazol-1-yl]ethyl N-benzylcarbamate.
| Compound Name | 2-[2-(hydroxymethyl)imidazol-1-yl]ethyl N-benzylcarbamate |
|---|---|
| PubChem CID | 139970374 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[2-(hydroxymethyl)imidazol-1-yl]ethyl N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)OCCn1ccnc1CO |
| InChI | InChI=1S/C14H17N3O3/c18-11-13-15-6-7-17(13)8-9-20-14(19)16-10-12-4-2-1-3-5-12/h1-7,18H,8-11H2,(H,16,19) |
| InChIKey | JLBYDOYFUMKARK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |