C17H26Cl2N4O2 — CID 120597422
4-amino-3-methoxy-N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]butanamide;dihydrochloride (PubChem CID 120597422) has the molecular formula C17H26Cl2N4O2 and a molecular weight of 389.33 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]butanamide;dihydrochloride.
| Compound Name | 4-amino-3-methoxy-N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 120597422 |
| Molecular Formula | C17H26Cl2N4O2 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-amino-3-methoxy-N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]butanamide;dihydrochloride |
| SMILES | COC(CN)CC(=O)NCc1nccn1CCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C17H24N4O2.2ClH/c1-23-15(12-18)11-17(22)20-13-16-19-8-10-21(16)9-7-14-5-3-2-4-6-14;;/h2-6,8,10,15H,7,9,11-13,18H2,1H3,(H,20,22);2*1H |
| InChIKey | RCJGKTGBKRZXGU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |