C18H28Cl2N4O2 — CID 120597418
4-amino-3-methoxy-N-[[1-(3-phenylpropyl)imidazol-2-yl]methyl]butanamide;dihydrochloride (PubChem CID 120597418) has the molecular formula C18H28Cl2N4O2 and a molecular weight of 403.35 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[[1-(3-phenylpropyl)imidazol-2-yl]methyl]butanamide;dihydrochloride.
| Compound Name | 4-amino-3-methoxy-N-[[1-(3-phenylpropyl)imidazol-2-yl]methyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 120597418 |
| Molecular Formula | C18H28Cl2N4O2 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 4-amino-3-methoxy-N-[[1-(3-phenylpropyl)imidazol-2-yl]methyl]butanamide;dihydrochloride |
| SMILES | COC(CN)CC(=O)NCc1nccn1CCCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C18H26N4O2.2ClH/c1-24-16(13-19)12-18(23)21-14-17-20-9-11-22(17)10-5-8-15-6-3-2-4-7-15;;/h2-4,6-7,9,11,16H,5,8,10,12-14,19H2,1H3,(H,21,23);2*1H |
| InChIKey | KZWREBVDOHNPQA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |