C22H28Cl2N4O — CID 120613454
3-(2-aminophenyl)-N-[[1-(3-phenylpropyl)imidazol-2-yl]methyl]propanamide;dihydrochloride (PubChem CID 120613454) has the molecular formula C22H28Cl2N4O and a molecular weight of 435.40 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[[1-(3-phenylpropyl)imidazol-2-yl]methyl]propanamide;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[[1-(3-phenylpropyl)imidazol-2-yl]methyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120613454 |
| Molecular Formula | C22H28Cl2N4O |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 3-(2-aminophenyl)-N-[[1-(3-phenylpropyl)imidazol-2-yl]methyl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1CCC(=O)NCc1nccn1CCCc1ccccc1 |
| InChI | InChI=1S/C22H26N4O.2ClH/c23-20-11-5-4-10-19(20)12-13-22(27)25-17-21-24-14-16-26(21)15-6-9-18-7-2-1-3-8-18;;/h1-5,7-8,10-11,14,16H,6,9,12-13,15,17,23H2,(H,25,27);2*1H |
| InChIKey | XSCQQKZIYSNYSZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|