C14H30O3 — CID 139970440
1-(2,3,3-trimethylbutan-2-ylperoxy)heptan-1-ol (PubChem CID 139970440) has the molecular formula C14H30O3 and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-(2,3,3-trimethylbutan-2-ylperoxy)heptan-1-ol.
| Compound Name | 1-(2,3,3-trimethylbutan-2-ylperoxy)heptan-1-ol |
|---|---|
| PubChem CID | 139970440 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 1-(2,3,3-trimethylbutan-2-ylperoxy)heptan-1-ol |
| SMILES | CCCCCCC(O)OOC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O3/c1-7-8-9-10-11-12(15)16-17-14(5,6)13(2,3)4/h12,15H,7-11H2,1-6H3 |
| InChIKey | NQKMAWHXYIRUGP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|