C36H62O6 — CID 139970694
2-[4-[1-(9,9-dimethyldecanoylperoxy)propan-2-yl]phenyl]propyl 9,9-dimethyldecaneperoxoate (PubChem CID 139970694) has the molecular formula C36H62O6 and a molecular weight of 590.89 g/mol. Its IUPAC name is 2-[4-[1-(9,9-dimethyldecanoylperoxy)propan-2-yl]phenyl]propyl 9,9-dimethyldecaneperoxoate.
| Compound Name | 2-[4-[1-(9,9-dimethyldecanoylperoxy)propan-2-yl]phenyl]propyl 9,9-dimethyldecaneperoxoate |
|---|---|
| PubChem CID | 139970694 |
| Molecular Formula | C36H62O6 |
| Molecular Weight | 590.89 g/mol |
| Exact Mass | 590.45 |
| IUPAC Name | 2-[4-[1-(9,9-dimethyldecanoylperoxy)propan-2-yl]phenyl]propyl 9,9-dimethyldecaneperoxoate |
| SMILES | CC(COOC(=O)CCCCCCCC(C)(C)C)c1ccc(C(C)COOC(=O)CCCCCCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C36H62O6/c1-29(27-39-41-33(37)19-15-11-9-13-17-25-35(3,4)5)31-21-23-32(24-22-31)30(2)28-40-42-34(38)20-16-12-10-14-18-26-36(6,7)8/h21-24,29-30H,9-20,25-28H2,1-8H3 |
| InChIKey | LVZWVTNXVKLKQU-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.89 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|