C32H54O6 — CID 22069588
[2-(7,7-dimethyloctanoylperoxy)-3,4-di(propan-2-yl)phenyl] 7,7-dimethyloctaneperoxoate (PubChem CID 22069588) has the molecular formula C32H54O6 and a molecular weight of 534.78 g/mol. Its IUPAC name is [2-(7,7-dimethyloctanoylperoxy)-3,4-di(propan-2-yl)phenyl] 7,7-dimethyloctaneperoxoate.
| Compound Name | [2-(7,7-dimethyloctanoylperoxy)-3,4-di(propan-2-yl)phenyl] 7,7-dimethyloctaneperoxoate |
|---|---|
| PubChem CID | 22069588 |
| Molecular Formula | C32H54O6 |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.39 |
| IUPAC Name | [2-(7,7-dimethyloctanoylperoxy)-3,4-di(propan-2-yl)phenyl] 7,7-dimethyloctaneperoxoate |
| SMILES | CC(C)c1ccc(OOC(=O)CCCCCC(C)(C)C)c(OOC(=O)CCCCCC(C)(C)C)c1C(C)C |
| InChI | InChI=1S/C32H54O6/c1-23(2)25-19-20-26(35-36-27(33)17-13-11-15-21-31(5,6)7)30(29(25)24(3)4)38-37-28(34)18-14-12-16-22-32(8,9)10/h19-20,23-24H,11-18,21-22H2,1-10H3 |
| InChIKey | YOXYDDHVYSDIOV-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|