C10H18N2S3 — CID 139971849
3,5-bis(2-methylpropylsulfanyl)-1,2,4-thiadiazole (PubChem CID 139971849) has the molecular formula C10H18N2S3 and a molecular weight of 262.47 g/mol. Its IUPAC name is 3,5-bis(2-methylpropylsulfanyl)-1,2,4-thiadiazole.
| Compound Name | 3,5-bis(2-methylpropylsulfanyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 139971849 |
| Molecular Formula | C10H18N2S3 |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3,5-bis(2-methylpropylsulfanyl)-1,2,4-thiadiazole |
| SMILES | CC(C)CSc1nsc(SCC(C)C)n1 |
| InChI | InChI=1S/C10H18N2S3/c1-7(2)5-13-9-11-10(15-12-9)14-6-8(3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | PXAVLVHFMKENKF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |