C22H39OP — CID 139972852
bis(2-methylbutan-2-yl)-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl]phosphane (PubChem CID 139972852) has the molecular formula C22H39OP and a molecular weight of 350.53 g/mol. Its IUPAC name is bis(2-methylbutan-2-yl)-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl]phosphane.
| Compound Name | bis(2-methylbutan-2-yl)-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl]phosphane |
|---|---|
| PubChem CID | 139972852 |
| Molecular Formula | C22H39OP |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | bis(2-methylbutan-2-yl)-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl]phosphane |
| SMILES | CCC(C)(C)P(CCc1ccc(OC(C)(C)C)cc1)C(C)(C)CC |
| InChI | InChI=1S/C22H39OP/c1-10-21(6,7)24(22(8,9)11-2)17-16-18-12-14-19(15-13-18)23-20(3,4)5/h12-15H,10-11,16-17H2,1-9H3 |
| InChIKey | WEUWRWIKWDARTG-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|