C14H20O2 — CID 139973361
6-methoxy-7-methyl-2-propyl-3,4-dihydro-2H-chromene (PubChem CID 139973361) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 6-methoxy-7-methyl-2-propyl-3,4-dihydro-2H-chromene.
| Compound Name | 6-methoxy-7-methyl-2-propyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 139973361 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 6-methoxy-7-methyl-2-propyl-3,4-dihydro-2H-chromene |
| SMILES | CCCC1CCc2cc(OC)c(C)cc2O1 |
| InChI | InChI=1S/C14H20O2/c1-4-5-12-7-6-11-9-13(15-3)10(2)8-14(11)16-12/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | YNJWTCBSCYZTIZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |