C22H25N5O — CID 139973865
2,9-dimethyl-N-[3-(pyridin-3-ylmethoxy)phenyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-5-amine (PubChem CID 139973865) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is 2,9-dimethyl-N-[3-(pyridin-3-ylmethoxy)phenyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-5-amine.
| Compound Name | 2,9-dimethyl-N-[3-(pyridin-3-ylmethoxy)phenyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-5-amine |
|---|---|
| PubChem CID | 139973865 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 2,9-dimethyl-N-[3-(pyridin-3-ylmethoxy)phenyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-5-amine |
| SMILES | Cc1ncc2c(n1)N(C)CCCC2Nc1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C22H25N5O/c1-16-24-14-20-21(9-5-11-27(2)22(20)25-16)26-18-7-3-8-19(12-18)28-15-17-6-4-10-23-13-17/h3-4,6-8,10,12-14,21,26H,5,9,11,15H2,1-2H3 |
| InChIKey | CFRHJACVZRVMOK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |