C9H16F3NaO3S — CID 139974263
sodium 1,1,1-trifluorononane-2-sulfonate (PubChem CID 139974263) has the molecular formula C9H16F3NaO3S and a molecular weight of 284.27 g/mol. Its IUPAC name is sodium 1,1,1-trifluorononane-2-sulfonate.
| Compound Name | sodium 1,1,1-trifluorononane-2-sulfonate |
|---|---|
| PubChem CID | 139974263 |
| Molecular Formula | C9H16F3NaO3S |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | sodium 1,1,1-trifluorononane-2-sulfonate |
| SMILES | CCCCCCCC(C(F)(F)F)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H17F3O3S.Na/c1-2-3-4-5-6-7-8(9(10,11)12)16(13,14)15;/h8H,2-7H2,1H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | GOEVFURHEBNILC-UHFFFAOYSA-M |
| XLogP | -0.17 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|