C19H20N2O2S — CID 139975631
2-[2-[[phenyl(prop-2-enyl)carbamothioyl]amino]phenyl]propanoic acid (PubChem CID 139975631) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-[2-[[phenyl(prop-2-enyl)carbamothioyl]amino]phenyl]propanoic acid.
| Compound Name | 2-[2-[[phenyl(prop-2-enyl)carbamothioyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 139975631 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-[2-[[phenyl(prop-2-enyl)carbamothioyl]amino]phenyl]propanoic acid |
| SMILES | C=CCN(C(=S)Nc1ccccc1C(C)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O2S/c1-3-13-21(15-9-5-4-6-10-15)19(24)20-17-12-8-7-11-16(17)14(2)18(22)23/h3-12,14H,1,13H2,2H3,(H,20,24)(H,22,23) |
| InChIKey | WYAAHJMOUPVYFE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|