C18H16F3NO4S — CID 139975822
[3-(4-cyanophenyl)-3-[3-(trifluoromethyl)phenoxy]propyl] methanesulfonate (PubChem CID 139975822) has the molecular formula C18H16F3NO4S and a molecular weight of 399.39 g/mol. Its IUPAC name is [3-(4-cyanophenyl)-3-[3-(trifluoromethyl)phenoxy]propyl] methanesulfonate.
| Compound Name | [3-(4-cyanophenyl)-3-[3-(trifluoromethyl)phenoxy]propyl] methanesulfonate |
|---|---|
| PubChem CID | 139975822 |
| Molecular Formula | C18H16F3NO4S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [3-(4-cyanophenyl)-3-[3-(trifluoromethyl)phenoxy]propyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCCC(Oc1cccc(C(F)(F)F)c1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H16F3NO4S/c1-27(23,24)25-10-9-17(14-7-5-13(12-22)6-8-14)26-16-4-2-3-15(11-16)18(19,20)21/h2-8,11,17H,9-10H2,1H3 |
| InChIKey | MFXNGUMLNZPARU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|