C30H30F6N2O8 — CID 139975835
9-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(2-methoxyethyl)-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione (PubChem CID 139975835) has the molecular formula C30H30F6N2O8 and a molecular weight of 660.56 g/mol. Its IUPAC name is 9-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(2-methoxyethyl)-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione.
| Compound Name | 9-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(2-methoxyethyl)-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione |
|---|---|
| PubChem CID | 139975835 |
| Molecular Formula | C30H30F6N2O8 |
| Molecular Weight | 660.56 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | 9-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-14-(2-methoxyethyl)-1,4,12-trioxa-9,14-diazadispiro[4.0.56.35]tetradecane-2,3,13-trione |
| SMILES | COCCN1C(=O)OC2(CCN(CCCOC(c3cccc(C(F)(F)F)c3)c3cccc(C(F)(F)F)c3)CC2)C12OC(=O)C(=O)O2 |
| InChI | InChI=1S/C30H30F6N2O8/c1-42-16-14-38-26(41)46-27(30(38)44-24(39)25(40)45-30)9-12-37(13-10-27)11-4-15-43-23(19-5-2-7-21(17-19)28(31,32)33)20-6-3-8-22(18-20)29(34,35)36/h2-3,5-8,17-18,23H,4,9-16H2,1H3 |
| InChIKey | LVXMPJQYVPUAEL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|