About fluoro(trihexoxy)silane
fluoro(trihexoxy)silane (PubChem CID 139977145) has the molecular formula C18H39FO3Si
and a molecular weight of 350.59 g/mol. Its IUPAC name is fluoro(trihexoxy)silane.
Molecular Properties
| Compound Name | fluoro(trihexoxy)silane |
| PubChem CID | 139977145 |
| Molecular Formula | C18H39FO3Si |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | fluoro(trihexoxy)silane |
| SMILES | CCCCCCO[Si](F)(OCCCCCC)OCCCCCC |
| InChI | InChI=1S/C18H39FO3Si/c1-4-7-10-13-16-20-23(19,21-17-14-11-8-5-2)22-18-15-12-9-6-3/h4-18H2,1-3H3 |
| InChIKey | LLPZGNIBHCMRNT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze fluoro(trihexoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro(trihexoxy)silane?
The IUPAC name of fluoro(trihexoxy)silane (CID 139977145) is fluoro(trihexoxy)silane.
What is the SMILES notation for fluoro(trihexoxy)silane?
The canonical SMILES for fluoro(trihexoxy)silane is CCCCCCO[Si](F)(OCCCCCC)OCCCCCC.
What is the InChIKey of fluoro(trihexoxy)silane?
The InChIKey is LLPZGNIBHCMRNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39FO3Si/c1-4-7-10-13-16-20-23(19,21-17-14-11-8-5-2)22-18-15-12-9-6-3/h4-18H2,1-3H3.
What are the key properties of fluoro(trihexoxy)silane?
fluoro(trihexoxy)silane has a molecular weight of 350.59 g/mol, XLogP of 6.18, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro(trihexoxy)silane is sourced from PubChem (CID 139977145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).