C10H19NO2 — CID 139977637
(2S)-2-[cyclohexyl(deuteriomethyl)amino]propanoic acid (PubChem CID 139977637) has the molecular formula C10H19NO2 and a molecular weight of 186.27 g/mol. Its IUPAC name is (2S)-2-[cyclohexyl(deuteriomethyl)amino]propanoic acid.
| Compound Name | (2S)-2-[cyclohexyl(deuteriomethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 139977637 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | (2S)-2-[cyclohexyl(deuteriomethyl)amino]propanoic acid |
| SMILES | [2H]CN(C1CCCCC1)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C10H19NO2/c1-8(10(12)13)11(2)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,12,13)/t8-/m0/s1/i2D |
| InChIKey | WTDHSXGBDZBWAW-AXGAATRCSA-N |
| XLogP | 1.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |