C10H19NO2 — CID 22906743
2-[cyclohexyl(methyl)amino]propanoic acid (PubChem CID 22906743) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-[cyclohexyl(methyl)amino]propanoic acid.
| Compound Name | 2-[cyclohexyl(methyl)amino]propanoic acid |
|---|---|
| PubChem CID | 22906743 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2-[cyclohexyl(methyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C10H19NO2/c1-8(10(12)13)11(2)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | WTDHSXGBDZBWAW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |