C7H14N4O3 — CID 139979655
1-N-hydroxy-2-methylpiperazine-1,2-dicarboxamide (PubChem CID 139979655) has the molecular formula C7H14N4O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 1-N-hydroxy-2-methylpiperazine-1,2-dicarboxamide.
| Compound Name | 1-N-hydroxy-2-methylpiperazine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 139979655 |
| Molecular Formula | C7H14N4O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-N-hydroxy-2-methylpiperazine-1,2-dicarboxamide |
| SMILES | CC1(C(N)=O)CNCCN1C(=O)NO |
| InChI | InChI=1S/C7H14N4O3/c1-7(5(8)12)4-9-2-3-11(7)6(13)10-14/h9,14H,2-4H2,1H3,(H2,8,12)(H,10,13) |
| InChIKey | IVFVWMFFQUXMLR-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|