C11H9NOS — CID 139979831
4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-10-thione (PubChem CID 139979831) has the molecular formula C11H9NOS and a molecular weight of 203.27 g/mol. Its IUPAC name is 4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-10-thione.
| Compound Name | 4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-10-thione |
|---|---|
| PubChem CID | 139979831 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-10-thione |
| SMILES | S=c1ccn2c3c(cccc13)OCC2 |
| InChI | InChI=1S/C11H9NOS/c14-10-4-5-12-6-7-13-9-3-1-2-8(10)11(9)12/h1-5H,6-7H2 |
| InChIKey | RWHRUHQDRKWNBZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|