C13H14ClNO2 — CID 139980455
4-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)butane-1,2-dione (PubChem CID 139980455) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 4-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)butane-1,2-dione.
| Compound Name | 4-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)butane-1,2-dione |
|---|---|
| PubChem CID | 139980455 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 4-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)butane-1,2-dione |
| SMILES | O=C(CCCl)C(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H14ClNO2/c14-7-5-12(16)13(17)15-8-6-10-3-1-2-4-11(10)9-15/h1-4H,5-9H2 |
| InChIKey | XSRYPHBLDVEWJD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|