C24H26FN2NaO3 — CID 139984148
sodium 4-[2-[[(3R)-1-[(6-fluoronaphthalen-2-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethylidene]cyclohexane-1-carboxylate (PubChem CID 139984148) has the molecular formula C24H26FN2NaO3 and a molecular weight of 432.47 g/mol. Its IUPAC name is sodium 4-[2-[[(3R)-1-[(6-fluoronaphthalen-2-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethylidene]cyclohexane-1-carboxylate.
| Compound Name | sodium 4-[2-[[(3R)-1-[(6-fluoronaphthalen-2-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethylidene]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139984148 |
| Molecular Formula | C24H26FN2NaO3 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | sodium 4-[2-[[(3R)-1-[(6-fluoronaphthalen-2-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethylidene]cyclohexane-1-carboxylate |
| SMILES | O=C(C=C1CCC(C(=O)[O-])CC1)N[C@@H]1CCN(Cc2ccc3cc(F)ccc3c2)C1.[Na+] |
| InChI | InChI=1S/C24H27FN2O3.Na/c25-21-8-7-19-11-17(3-6-20(19)13-21)14-27-10-9-22(15-27)26-23(28)12-16-1-4-18(5-2-16)24(29)30;/h3,6-8,11-13,18,22H,1-2,4-5,9-10,14-15H2,(H,26,28)(H,29,30);/q;+1/p-1/b16-12-;/t18?,22-;/m1./s1 |
| InChIKey | OTTDFTKGAIJTAO-NGZQIROKSA-M |
| XLogP | -0.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|