C29H30FN3O3 — CID 45273632
N-[(3R)-1-[(6-fluoronaphthalen-2-yl)methyl]pyrrolidin-3-yl]-2-[1-(3-hydroxybenzoyl)piperidin-4-ylidene]acetamide (PubChem CID 45273632) has the molecular formula C29H30FN3O3 and a molecular weight of 487.58 g/mol. Its IUPAC name is N-[(3R)-1-[(6-fluoronaphthalen-2-yl)methyl]pyrrolidin-3-yl]-2-[1-(3-hydroxybenzoyl)piperidin-4-ylidene]acetamide.
| Compound Name | N-[(3R)-1-[(6-fluoronaphthalen-2-yl)methyl]pyrrolidin-3-yl]-2-[1-(3-hydroxybenzoyl)piperidin-4-ylidene]acetamide |
|---|---|
| PubChem CID | 45273632 |
| Molecular Formula | C29H30FN3O3 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N-[(3R)-1-[(6-fluoronaphthalen-2-yl)methyl]pyrrolidin-3-yl]-2-[1-(3-hydroxybenzoyl)piperidin-4-ylidene]acetamide |
| SMILES | O=C(C=C1CCN(C(=O)c2cccc(O)c2)CC1)N[C@@H]1CCN(Cc2ccc3cc(F)ccc3c2)C1 |
| InChI | InChI=1S/C29H30FN3O3/c30-25-7-6-22-14-21(4-5-23(22)16-25)18-32-11-10-26(19-32)31-28(35)15-20-8-12-33(13-9-20)29(36)24-2-1-3-27(34)17-24/h1-7,14-17,26,34H,8-13,18-19H2,(H,31,35)/t26-/m1/s1 |
| InChIKey | YOHNUIZUGOQKIN-AREMUKBSSA-N |
| XLogP | 4.24 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|