C22H20N2O5 — CID 139985990
6'-(2-phenoxyethyl)spiro[1,3-dioxolane-2,1'-2,3,4,5-tetrahydroazepino[4,5-b]indole]-4,5-dione (PubChem CID 139985990) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 6'-(2-phenoxyethyl)spiro[1,3-dioxolane-2,1'-2,3,4,5-tetrahydroazepino[4,5-b]indole]-4,5-dione.
| Compound Name | 6'-(2-phenoxyethyl)spiro[1,3-dioxolane-2,1'-2,3,4,5-tetrahydroazepino[4,5-b]indole]-4,5-dione |
|---|---|
| PubChem CID | 139985990 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 6'-(2-phenoxyethyl)spiro[1,3-dioxolane-2,1'-2,3,4,5-tetrahydroazepino[4,5-b]indole]-4,5-dione |
| SMILES | O=C1OC2(CNCCc3c2c2ccccc2n3CCOc2ccccc2)OC1=O |
| InChI | InChI=1S/C22H20N2O5/c25-20-21(26)29-22(28-20)14-23-11-10-18-19(22)16-8-4-5-9-17(16)24(18)12-13-27-15-6-2-1-3-7-15/h1-9,23H,10-14H2 |
| InChIKey | CBASQJPHQNKBFB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|