C39H27F5O5S3 — CID 139989828
[[4-(3-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate (PubChem CID 139989828) has the molecular formula C39H27F5O5S3 and a molecular weight of 766.83 g/mol. Its IUPAC name is [[4-(3-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate.
| Compound Name | [[4-(3-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139989828 |
| Molecular Formula | C39H27F5O5S3 |
| Molecular Weight | 766.83 g/mol |
| Exact Mass | 766.09 |
| IUPAC Name | [[4-(3-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(S(OS(=O)(=O)c2ccc(C)cc2)(c2ccc(Sc3cccc(C(=O)c4ccccc4)c3)cc2)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C39H27F5O5S3/c1-24-11-17-32(18-12-24)52(46,47)49-51(30-19-13-27(48-2)14-20-30,39-36(43)34(41)33(40)35(42)37(39)44)31-21-15-28(16-22-31)50-29-10-6-9-26(23-29)38(45)25-7-4-3-5-8-25/h3-23H,1-2H3 |
| InChIKey | RCGJMRIMZRBXJX-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.83 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|