C9H20LiN — CID 139991311
lithium (3-ethyl-2,4-dimethylpentan-3-yl)azanide (PubChem CID 139991311) has the molecular formula C9H20LiN and a molecular weight of 149.21 g/mol. Its IUPAC name is lithium (3-ethyl-2,4-dimethylpentan-3-yl)azanide.
| Compound Name | lithium (3-ethyl-2,4-dimethylpentan-3-yl)azanide |
|---|---|
| PubChem CID | 139991311 |
| Molecular Formula | C9H20LiN |
| Molecular Weight | 149.21 g/mol |
| Exact Mass | 149.18 |
| IUPAC Name | lithium (3-ethyl-2,4-dimethylpentan-3-yl)azanide |
| SMILES | CCC([NH-])(C(C)C)C(C)C.[Li+] |
| InChI | InChI=1S/C9H20N.Li/c1-6-9(10,7(2)3)8(4)5;/h7-8,10H,6H2,1-5H3;/q-1;+1 |
| InChIKey | WCNAVPHHGREMQY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |