C28H40N2O5 — CID 139991920
2-[1-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-N-pentan-3-ylacetamide (PubChem CID 139991920) has the molecular formula C28H40N2O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-[1-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-N-pentan-3-ylacetamide.
| Compound Name | 2-[1-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 139991920 |
| Molecular Formula | C28H40N2O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 2-[1-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CN1CCCc2cc(OC)c(OC)cc2C1Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H40N2O5/c1-7-21(8-2)29-28(31)18-30-13-9-10-20-16-26(34-5)27(35-6)17-22(20)23(30)14-19-11-12-24(32-3)25(15-19)33-4/h11-12,15-17,21,23H,7-10,13-14,18H2,1-6H3,(H,29,31) |
| InChIKey | GCAAEWKNAVDDFU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |