C13H21N7O3 — CID 139993317
(2S,3R,4S,5R)-2-(3-aminopropylamino)-2-(6-aminopurin-9-yl)-5-methyloxolane-3,4-diol (PubChem CID 139993317) has the molecular formula C13H21N7O3 and a molecular weight of 323.36 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(3-aminopropylamino)-2-(6-aminopurin-9-yl)-5-methyloxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(3-aminopropylamino)-2-(6-aminopurin-9-yl)-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 139993317 |
| Molecular Formula | C13H21N7O3 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (2S,3R,4S,5R)-2-(3-aminopropylamino)-2-(6-aminopurin-9-yl)-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@](NCCCN)(n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H21N7O3/c1-7-9(21)10(22)13(23-7,19-4-2-3-14)20-6-18-8-11(15)16-5-17-12(8)20/h5-7,9-10,19,21-22H,2-4,14H2,1H3,(H2,15,16,17)/t7-,9-,10-,13+/m1/s1 |
| InChIKey | LLRVKDYDTVCGAW-HMMKDHSLSA-N |
| XLogP | -1.90 |
| TPSA | 157.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|