C16H17NO2 — CID 139993842
2-(3,4-dimethylphenyl)-2-hydroxy-2-phenylacetamide (PubChem CID 139993842) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-2-hydroxy-2-phenylacetamide.
| Compound Name | 2-(3,4-dimethylphenyl)-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 139993842 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-2-hydroxy-2-phenylacetamide |
| SMILES | Cc1ccc(C(O)(C(N)=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C16H17NO2/c1-11-8-9-14(10-12(11)2)16(19,15(17)18)13-6-4-3-5-7-13/h3-10,19H,1-2H3,(H2,17,18) |
| InChIKey | OMCFJUYACISKHJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |