C13H13Cl3N4O — CID 139994548
[3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea (PubChem CID 139994548) has the molecular formula C13H13Cl3N4O and a molecular weight of 347.63 g/mol. Its IUPAC name is [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea.
| Compound Name | [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 139994548 |
| Molecular Formula | C13H13Cl3N4O |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea |
| SMILES | CC(C)c1cc(NC(N)=O)n(-c2c(Cl)cc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H13Cl3N4O/c1-6(2)10-5-11(18-13(17)21)20(19-10)12-8(15)3-7(14)4-9(12)16/h3-6H,1-2H3,(H3,17,18,21) |
| InChIKey | CQQNTJAJKVBVFU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |