About [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea
[3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea (PubChem CID 139994548) has the molecular formula C13H13Cl3N4O
and a molecular weight of 347.63 g/mol. Its IUPAC name is [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea.
Molecular Properties
| Compound Name | [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea |
| PubChem CID | 139994548 |
| Molecular Formula | C13H13Cl3N4O |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea |
| SMILES | CC(C)c1cc(NC(N)=O)n(-c2c(Cl)cc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H13Cl3N4O/c1-6(2)10-5-11(18-13(17)21)20(19-10)12-8(15)3-7(14)4-9(12)16/h3-6H,1-2H3,(H3,17,18,21) |
| InChIKey | CQQNTJAJKVBVFU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea?
The IUPAC name of [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea (CID 139994548) is [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea.
What is the SMILES notation for [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea?
The canonical SMILES for [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea is CC(C)c1cc(NC(N)=O)n(-c2c(Cl)cc(Cl)cc2Cl)n1.
What is the InChIKey of [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea?
The InChIKey is CQQNTJAJKVBVFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl3N4O/c1-6(2)10-5-11(18-13(17)21)20(19-10)12-8(15)3-7(14)4-9(12)16/h3-6H,1-2H3,(H3,17,18,21).
What are the key properties of [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea?
[3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea has a molecular weight of 347.63 g/mol, XLogP of 4.45, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-propan-2-yl-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]urea is sourced from PubChem (CID 139994548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).