C21H20N2O3 — CID 139998031
[3-[(3-methoxyphenyl)methoxy]phenyl]-[2-(methylamino)-3-pyridinyl]methanone (PubChem CID 139998031) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is [3-[(3-methoxyphenyl)methoxy]phenyl]-[2-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [3-[(3-methoxyphenyl)methoxy]phenyl]-[2-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 139998031 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [3-[(3-methoxyphenyl)methoxy]phenyl]-[2-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1ncccc1C(=O)c1cccc(OCc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C21H20N2O3/c1-22-21-19(10-5-11-23-21)20(24)16-7-4-9-18(13-16)26-14-15-6-3-8-17(12-15)25-2/h3-13H,14H2,1-2H3,(H,22,23) |
| InChIKey | LMTLINHSJKHSHE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |