C22H30N2O2 — CID 139998068
(3-ethoxyphenyl)-[2-(octylamino)-3-pyridinyl]methanone (PubChem CID 139998068) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is (3-ethoxyphenyl)-[2-(octylamino)-3-pyridinyl]methanone.
| Compound Name | (3-ethoxyphenyl)-[2-(octylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 139998068 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | (3-ethoxyphenyl)-[2-(octylamino)-3-pyridinyl]methanone |
| SMILES | CCCCCCCCNc1ncccc1C(=O)c1cccc(OCC)c1 |
| InChI | InChI=1S/C22H30N2O2/c1-3-5-6-7-8-9-15-23-22-20(14-11-16-24-22)21(25)18-12-10-13-19(17-18)26-4-2/h10-14,16-17H,3-9,15H2,1-2H3,(H,23,24) |
| InChIKey | PTGHSNLFBXDUQU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|