C26H38N2O2 — CID 139998170
[2-(decylamino)-3-pyridinyl]-[3-[(2-methylpropan-2-yl)oxy]phenyl]methanone (PubChem CID 139998170) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is [2-(decylamino)-3-pyridinyl]-[3-[(2-methylpropan-2-yl)oxy]phenyl]methanone.
| Compound Name | [2-(decylamino)-3-pyridinyl]-[3-[(2-methylpropan-2-yl)oxy]phenyl]methanone |
|---|---|
| PubChem CID | 139998170 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | [2-(decylamino)-3-pyridinyl]-[3-[(2-methylpropan-2-yl)oxy]phenyl]methanone |
| SMILES | CCCCCCCCCCNc1ncccc1C(=O)c1cccc(OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H38N2O2/c1-5-6-7-8-9-10-11-12-18-27-25-23(17-14-19-28-25)24(29)21-15-13-16-22(20-21)30-26(2,3)4/h13-17,19-20H,5-12,18H2,1-4H3,(H,27,28) |
| InChIKey | VCPRWZMYXWUYQE-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|