C20H26N2O — CID 139998090
(3-ethylphenyl)-[2-(hexylamino)-3-pyridinyl]methanone (PubChem CID 139998090) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (3-ethylphenyl)-[2-(hexylamino)-3-pyridinyl]methanone.
| Compound Name | (3-ethylphenyl)-[2-(hexylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 139998090 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (3-ethylphenyl)-[2-(hexylamino)-3-pyridinyl]methanone |
| SMILES | CCCCCCNc1ncccc1C(=O)c1cccc(CC)c1 |
| InChI | InChI=1S/C20H26N2O/c1-3-5-6-7-13-21-20-18(12-9-14-22-20)19(23)17-11-8-10-16(4-2)15-17/h8-12,14-15H,3-7,13H2,1-2H3,(H,21,22) |
| InChIKey | BKCBKQMERIBKTC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|