C27H34O — CID 139998292
5,9-bis(3-methylphenyl)trideca-5,8-dien-7-one (PubChem CID 139998292) has the molecular formula C27H34O and a molecular weight of 374.57 g/mol. Its IUPAC name is 5,9-bis(3-methylphenyl)trideca-5,8-dien-7-one.
| Compound Name | 5,9-bis(3-methylphenyl)trideca-5,8-dien-7-one |
|---|---|
| PubChem CID | 139998292 |
| Molecular Formula | C27H34O |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 5,9-bis(3-methylphenyl)trideca-5,8-dien-7-one |
| SMILES | CCCCC(=CC(=O)C=C(CCCC)c1cccc(C)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C27H34O/c1-5-7-13-25(23-15-9-11-21(3)17-23)19-27(28)20-26(14-8-6-2)24-16-10-12-22(4)18-24/h9-12,15-20H,5-8,13-14H2,1-4H3 |
| InChIKey | JQCSPQPIAIHZMY-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|