C26H27F6N3O4S — CID 139998659
[4-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-(4-methylphenyl)piperidin-4-yl]piperazin-1-yl]sulfonylformaldehyde (PubChem CID 139998659) has the molecular formula C26H27F6N3O4S and a molecular weight of 591.57 g/mol. Its IUPAC name is [4-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-(4-methylphenyl)piperidin-4-yl]piperazin-1-yl]sulfonylformaldehyde.
| Compound Name | [4-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-(4-methylphenyl)piperidin-4-yl]piperazin-1-yl]sulfonylformaldehyde |
|---|---|
| PubChem CID | 139998659 |
| Molecular Formula | C26H27F6N3O4S |
| Molecular Weight | 591.57 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | [4-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-(4-methylphenyl)piperidin-4-yl]piperazin-1-yl]sulfonylformaldehyde |
| SMILES | Cc1ccc(C2CN(C(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCC2N2CCN(S(=O)(=O)C=O)CC2)cc1 |
| InChI | InChI=1S/C26H27F6N3O4S/c1-17-2-4-18(5-3-17)22-15-34(7-6-23(22)33-8-10-35(11-9-33)40(38,39)16-36)24(37)19-12-20(25(27,28)29)14-21(13-19)26(30,31)32/h2-5,12-14,16,22-23H,6-11,15H2,1H3 |
| InChIKey | XMZVHWNHKAYVNC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|