C20H13N3S — CID 14000355
2,4-diphenyl-5-thiophen-2-ylpyrazole-3-carbonitrile (PubChem CID 14000355) has the molecular formula C20H13N3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2,4-diphenyl-5-thiophen-2-ylpyrazole-3-carbonitrile.
| Compound Name | 2,4-diphenyl-5-thiophen-2-ylpyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 14000355 |
| Molecular Formula | C20H13N3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2,4-diphenyl-5-thiophen-2-ylpyrazole-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)c(-c2cccs2)nn1-c1ccccc1 |
| InChI | InChI=1S/C20H13N3S/c21-14-17-19(15-8-3-1-4-9-15)20(18-12-7-13-24-18)22-23(17)16-10-5-2-6-11-16/h1-13H |
| InChIKey | FWRMXUNDOARWPG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |