C21H14N4OS — CID 12964793
4,6-diphenyl-2-thiophen-2-ylpyrazolo[1,5-d][1,2,4]triazin-7-one (PubChem CID 12964793) has the molecular formula C21H14N4OS and a molecular weight of 370.44 g/mol. Its IUPAC name is 4,6-diphenyl-2-thiophen-2-ylpyrazolo[1,5-d][1,2,4]triazin-7-one.
| Compound Name | 4,6-diphenyl-2-thiophen-2-ylpyrazolo[1,5-d][1,2,4]triazin-7-one |
|---|---|
| PubChem CID | 12964793 |
| Molecular Formula | C21H14N4OS |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 4,6-diphenyl-2-thiophen-2-ylpyrazolo[1,5-d][1,2,4]triazin-7-one |
| SMILES | O=c1n(-c2ccccc2)nc(-c2ccccc2)c2cc(-c3cccs3)nn12 |
| InChI | InChI=1S/C21H14N4OS/c26-21-24(16-10-5-2-6-11-16)23-20(15-8-3-1-4-9-15)18-14-17(22-25(18)21)19-12-7-13-27-19/h1-14H |
| InChIKey | FFCYQNBVOWTFDD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |