C13H21N — CID 14003985
9-methyl-1,2,3,4,5,6,7,8,8a,9a-decahydrocarbazole (PubChem CID 14003985) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 9-methyl-1,2,3,4,5,6,7,8,8a,9a-decahydrocarbazole.
| Compound Name | 9-methyl-1,2,3,4,5,6,7,8,8a,9a-decahydrocarbazole |
|---|---|
| PubChem CID | 14003985 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 9-methyl-1,2,3,4,5,6,7,8,8a,9a-decahydrocarbazole |
| SMILES | CN1C2CCCCC2=C2CCCCC21 |
| InChI | InChI=1S/C13H21N/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h12-13H,2-9H2,1H3 |
| InChIKey | YNNSMGGPAPOCRC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|