C15H22 — CID 14006170
3-(5,5-dimethylhexa-1,2,3-trienylidene)-1,1,2,2-tetramethylcyclopropane (PubChem CID 14006170) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 3-(5,5-dimethylhexa-1,2,3-trienylidene)-1,1,2,2-tetramethylcyclopropane.
| Compound Name | 3-(5,5-dimethylhexa-1,2,3-trienylidene)-1,1,2,2-tetramethylcyclopropane |
|---|---|
| PubChem CID | 14006170 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 3-(5,5-dimethylhexa-1,2,3-trienylidene)-1,1,2,2-tetramethylcyclopropane |
| SMILES | CC(C)(C)C=C=C=C=C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C15H22/c1-13(2,3)11-9-8-10-12-14(4,5)15(12,6)7/h11H,1-7H3 |
| InChIKey | CCWRFFHZEYSLBG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |