C10H6ClN5 — CID 14006342
5-chloro-3-phenyltriazolo[4,5-d]pyrimidine (PubChem CID 14006342) has the molecular formula C10H6ClN5 and a molecular weight of 231.65 g/mol. Its IUPAC name is 5-chloro-3-phenyltriazolo[4,5-d]pyrimidine.
| Compound Name | 5-chloro-3-phenyltriazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 14006342 |
| Molecular Formula | C10H6ClN5 |
| Molecular Weight | 231.65 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 5-chloro-3-phenyltriazolo[4,5-d]pyrimidine |
| SMILES | Clc1ncc2nnn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C10H6ClN5/c11-10-12-6-8-9(13-10)16(15-14-8)7-4-2-1-3-5-7/h1-6H |
| InChIKey | NKIVLXGSBRGGMK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.65 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |