CH8NO9P3 — CID 14009244
[amino(diphosphono)methyl]phosphonic acid (PubChem CID 14009244) has the molecular formula CH8NO9P3 and a molecular weight of 271.00 g/mol. Its IUPAC name is [amino(diphosphono)methyl]phosphonic acid.
| Compound Name | [amino(diphosphono)methyl]phosphonic acid |
|---|---|
| PubChem CID | 14009244 |
| Molecular Formula | CH8NO9P3 |
| Molecular Weight | 271.00 g/mol |
| Exact Mass | 270.94 |
| IUPAC Name | [amino(diphosphono)methyl]phosphonic acid |
| SMILES | NC(P(=O)(O)O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/CH8NO9P3/c2-1(12(3,4)5,13(6,7)8)14(9,10)11/h2H2,(H2,3,4,5)(H2,6,7,8)(H2,9,10,11) |
| InChIKey | QXYWABRLQXYJCP-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 198.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.00 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|