C3H13NO9P2S — CID 59034102
[1-amino-1-phosphono-3-(trihydroxy-λ4-sulfanyl)propyl]phosphonic acid (PubChem CID 59034102) has the molecular formula C3H13NO9P2S and a molecular weight of 301.15 g/mol. Its IUPAC name is [1-amino-1-phosphono-3-(trihydroxy-λ4-sulfanyl)propyl]phosphonic acid.
| Compound Name | [1-amino-1-phosphono-3-(trihydroxy-λ4-sulfanyl)propyl]phosphonic acid |
|---|---|
| PubChem CID | 59034102 |
| Molecular Formula | C3H13NO9P2S |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | [1-amino-1-phosphono-3-(trihydroxy-λ4-sulfanyl)propyl]phosphonic acid |
| SMILES | NC(CCS(O)(O)O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C3H13NO9P2S/c4-3(14(5,6)7,15(8,9)10)1-2-16(11,12)13/h11-13H,1-2,4H2,(H2,5,6,7)(H2,8,9,10) |
| InChIKey | YXBQIZPSNWHGCN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 201.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|