C28H34N6OS — CID 14013047
2-methyl-3-[2-[4-[[1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 14013047) has the molecular formula C28H34N6OS and a molecular weight of 502.69 g/mol. Its IUPAC name is 2-methyl-3-[2-[4-[[1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-methyl-3-[2-[4-[[1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 14013047 |
| Molecular Formula | C28H34N6OS |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 2-methyl-3-[2-[4-[[1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1nc2n(c(=O)c1CCN1CCC(Cc3nc4ccccc4n3Cc3cscn3)CC1)CCCC2 |
| InChI | InChI=1S/C28H34N6OS/c1-20-23(28(35)33-12-5-4-8-26(33)30-20)11-15-32-13-9-21(10-14-32)16-27-31-24-6-2-3-7-25(24)34(27)17-22-18-36-19-29-22/h2-3,6-7,18-19,21H,4-5,8-17H2,1H3 |
| InChIKey | IILJUTMJYKJEJM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |