C28H31N5O9S — CID 67895676
N-[1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine;oxalic acid (PubChem CID 67895676) has the molecular formula C28H31N5O9S and a molecular weight of 613.65 g/mol. Its IUPAC name is N-[1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine;oxalic acid.
| Compound Name | N-[1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 67895676 |
| Molecular Formula | C28H31N5O9S |
| Molecular Weight | 613.65 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | N-[1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine;oxalic acid |
| SMILES | COc1ccc(CCN2CCC(Nc3nc4ccccc4n3Cc3cscn3)C2)cc1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H27N5OS.2C2H2O4/c1-30-21-8-6-18(7-9-21)10-12-28-13-11-19(14-28)26-24-27-22-4-2-3-5-23(22)29(24)15-20-16-31-17-25-20;2*3-1(4)2(5)6/h2-9,16-17,19H,10-15H2,1H3,(H,26,27);2*(H,3,4)(H,5,6) |
| InChIKey | RDHPXQZALJQWCC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 204.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.65 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|